C10H13NO2S — CID 142853679
(3E)-2-methylidene-3-propylsulfonylhexa-3,5-dienenitrile (PubChem CID 142853679) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is (3E)-2-methylidene-3-propylsulfonylhexa-3,5-dienenitrile.
| Compound Name | (3E)-2-methylidene-3-propylsulfonylhexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142853679 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (3E)-2-methylidene-3-propylsulfonylhexa-3,5-dienenitrile |
| SMILES | C=C/C=C(\C(=C)C#N)S(=O)(=O)CCC |
| InChI | InChI=1S/C10H13NO2S/c1-4-6-10(9(3)8-11)14(12,13)7-5-2/h4,6H,1,3,5,7H2,2H3/b10-6+ |
| InChIKey | CQXCNEWUJJWBEJ-UXBLZVDNSA-N |
| XLogP | 1.96 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|