C8H8FNO2S — CID 118396461
(3E)-3-fluoro-2-methylidene-5-methylsulfonylhexa-3,5-dienenitrile (PubChem CID 118396461) has the molecular formula C8H8FNO2S and a molecular weight of 201.22 g/mol. Its IUPAC name is (3E)-3-fluoro-2-methylidene-5-methylsulfonylhexa-3,5-dienenitrile.
| Compound Name | (3E)-3-fluoro-2-methylidene-5-methylsulfonylhexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 118396461 |
| Molecular Formula | C8H8FNO2S |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | (3E)-3-fluoro-2-methylidene-5-methylsulfonylhexa-3,5-dienenitrile |
| SMILES | C=C(C#N)/C(F)=C\C(=C)S(C)(=O)=O |
| InChI | InChI=1S/C8H8FNO2S/c1-6(5-10)8(9)4-7(2)13(3,11)12/h4H,1-2H2,3H3/b8-4+ |
| InChIKey | RFBOMSCNEQTIGC-XBXARRHUSA-N |
| XLogP | 1.48 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|