C11H19NO4 — CID 10036781
2-but-3-enoxy-2,4-dimethyl-1-nitropentan-3-one (PubChem CID 10036781) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-but-3-enoxy-2,4-dimethyl-1-nitropentan-3-one.
| Compound Name | 2-but-3-enoxy-2,4-dimethyl-1-nitropentan-3-one |
|---|---|
| PubChem CID | 10036781 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-but-3-enoxy-2,4-dimethyl-1-nitropentan-3-one |
| SMILES | C=CCCOC(C)(C[N+](=O)[O-])C(=O)C(C)C |
| InChI | InChI=1S/C11H19NO4/c1-5-6-7-16-11(4,8-12(14)15)10(13)9(2)3/h5,9H,1,6-8H2,2-4H3 |
| InChIKey | PUBKHWPCOCRKSM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|