C17H16O5S — CID 10042385
2-(benzenesulfonyl)-3-(2,2-dimethylpropanoyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 10042385) has the molecular formula C17H16O5S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(2,2-dimethylpropanoyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(benzenesulfonyl)-3-(2,2-dimethylpropanoyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10042385 |
| Molecular Formula | C17H16O5S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(2,2-dimethylpropanoyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)C(=O)C1=C(S(=O)(=O)c2ccccc2)C(=O)C=CC1=O |
| InChI | InChI=1S/C17H16O5S/c1-17(2,3)16(20)14-12(18)9-10-13(19)15(14)23(21,22)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | OXOABZSZLXJFBJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|