C23H28O4S — CID 10046558
(1R,2S,5S,6S,7S)-7-(benzenesulfonyl)-2,6,7-trimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane (PubChem CID 10046558) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is (1R,2S,5S,6S,7S)-7-(benzenesulfonyl)-2,6,7-trimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane.
| Compound Name | (1R,2S,5S,6S,7S)-7-(benzenesulfonyl)-2,6,7-trimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10046558 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (1R,2S,5S,6S,7S)-7-(benzenesulfonyl)-2,6,7-trimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane |
| SMILES | C[C@H]1[C@@H]2CC[C@](C)(OCc3ccccc3)[C@@H](O2)[C@@]1(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H28O4S/c1-17-20-14-15-22(2,26-16-18-10-6-4-7-11-18)21(27-20)23(17,3)28(24,25)19-12-8-5-9-13-19/h4-13,17,20-21H,14-16H2,1-3H3/t17-,20-,21+,22-,23-/m0/s1 |
| InChIKey | DBCVCFUNFNAHSP-CZIXKKEKSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |