C23H28O5S — CID 134844365
(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-2-(phenylmethoxymethyl)-5-prop-2-enyloxolane (PubChem CID 134844365) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is (2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-2-(phenylmethoxymethyl)-5-prop-2-enyloxolane.
| Compound Name | (2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-2-(phenylmethoxymethyl)-5-prop-2-enyloxolane |
|---|---|
| PubChem CID | 134844365 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-2-(phenylmethoxymethyl)-5-prop-2-enyloxolane |
| SMILES | C=CC[C@@H]1O[C@H](COCc2ccccc2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H28O5S/c1-3-10-21-20(17-29(24,25)19-13-8-5-9-14-19)23(26-2)22(28-21)16-27-15-18-11-6-4-7-12-18/h3-9,11-14,20-23H,1,10,15-17H2,2H3/t20-,21-,22+,23+/m0/s1 |
| InChIKey | PLBUFSDVYPQTDL-MYDTUXCISA-N |
| XLogP | 3.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|