C25H22O5 — CID 10046675
methyl (1S,5R,7R)-6,6-dimethyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate (PubChem CID 10046675) has the molecular formula C25H22O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is methyl (1S,5R,7R)-6,6-dimethyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate.
| Compound Name | methyl (1S,5R,7R)-6,6-dimethyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate |
|---|---|
| PubChem CID | 10046675 |
| Molecular Formula | C25H22O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | methyl (1S,5R,7R)-6,6-dimethyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)[C@@]3(C(=O)OC[C@@H]3C1(C)C)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C25H22O5/c1-23(2)17-14-30-21(27)24(17)18(15-10-6-4-7-11-15)19(16-12-8-5-9-13-16)25(23,20(24)26)22(28)29-3/h4-13,17H,14H2,1-3H3/t17-,24+,25+/m1/s1 |
| InChIKey | VCELXMMRSHCPIZ-XATISFHKSA-N |
| XLogP | 3.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|