C19H20O4 — CID 10591193
methyl (3aS,3bS,6S,6aS,7aS)-5-methylidene-1-oxo-6-phenyl-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate (PubChem CID 10591193) has the molecular formula C19H20O4 and a molecular weight of 312.36 g/mol. Its IUPAC name is methyl (3aS,3bS,6S,6aS,7aS)-5-methylidene-1-oxo-6-phenyl-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate.
| Compound Name | methyl (3aS,3bS,6S,6aS,7aS)-5-methylidene-1-oxo-6-phenyl-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
|---|---|
| PubChem CID | 10591193 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | methyl (3aS,3bS,6S,6aS,7aS)-5-methylidene-1-oxo-6-phenyl-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
| SMILES | C=C1C[C@@]2(C(=O)OC)[C@H]3COC(=O)[C@H]3C[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20O4/c1-11-9-19(18(21)22-2)14(8-13-15(19)10-23-17(13)20)16(11)12-6-4-3-5-7-12/h3-7,13-16H,1,8-10H2,2H3/t13-,14-,15-,16-,19-/m0/s1 |
| InChIKey | NAJPXVKZHGFGSZ-GMHRPJKWSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|