C25H22O6 — CID 139038307
dimethyl (1R,2R,6S,7S)-10-oxo-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-1,7-dicarboxylate (PubChem CID 139038307) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is dimethyl (1R,2R,6S,7S)-10-oxo-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-1,7-dicarboxylate.
| Compound Name | dimethyl (1R,2R,6S,7S)-10-oxo-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-1,7-dicarboxylate |
|---|---|
| PubChem CID | 139038307 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | dimethyl (1R,2R,6S,7S)-10-oxo-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-1,7-dicarboxylate |
| SMILES | COC(=O)[C@@]12C(=O)[C@@](C(=O)OC)(C(c3ccccc3)=C1c1ccccc1)[C@H]1COC[C@H]12 |
| InChI | InChI=1S/C25H22O6/c1-29-22(27)24-17-13-31-14-18(17)25(21(24)26,23(28)30-2)20(16-11-7-4-8-12-16)19(24)15-9-5-3-6-10-15/h3-12,17-18H,13-14H2,1-2H3/t17-,18+,24-,25+ |
| InChIKey | DVCQPTBNAUULJE-HVXQOBHKSA-N |
| XLogP | 2.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|