C27H26F2O — CID 10046817
1-(4-benzylphenyl)-1,1-difluoro-4-(2-phenylethyl)hex-5-en-2-one (PubChem CID 10046817) has the molecular formula C27H26F2O and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-(4-benzylphenyl)-1,1-difluoro-4-(2-phenylethyl)hex-5-en-2-one.
| Compound Name | 1-(4-benzylphenyl)-1,1-difluoro-4-(2-phenylethyl)hex-5-en-2-one |
|---|---|
| PubChem CID | 10046817 |
| Molecular Formula | C27H26F2O |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-(4-benzylphenyl)-1,1-difluoro-4-(2-phenylethyl)hex-5-en-2-one |
| SMILES | C=CC(CCc1ccccc1)CC(=O)C(F)(F)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26F2O/c1-2-21(13-14-22-9-5-3-6-10-22)20-26(30)27(28,29)25-17-15-24(16-18-25)19-23-11-7-4-8-12-23/h2-12,15-18,21H,1,13-14,19-20H2 |
| InChIKey | GXVIGVLZKIVXMN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|