C20H22O — CID 134956601
(3R)-3-ethenyl-1,6-diphenylhexan-1-one (PubChem CID 134956601) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is (3R)-3-ethenyl-1,6-diphenylhexan-1-one.
| Compound Name | (3R)-3-ethenyl-1,6-diphenylhexan-1-one |
|---|---|
| PubChem CID | 134956601 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3R)-3-ethenyl-1,6-diphenylhexan-1-one |
| SMILES | C=C[C@H](CCCc1ccccc1)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O/c1-2-17(12-9-13-18-10-5-3-6-11-18)16-20(21)19-14-7-4-8-15-19/h2-8,10-11,14-15,17H,1,9,12-13,16H2/t17-/m1/s1 |
| InChIKey | LXCSOJFLMCCXAB-QGZVFWFLSA-N |
| XLogP | 5.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|