C23H35N3O4S2 — CID 10050898
methyl (2S)-2-[[(2S,4R)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-methoxyphenyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 10050898) has the molecular formula C23H35N3O4S2 and a molecular weight of 481.68 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,4R)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-methoxyphenyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S,4R)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-methoxyphenyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 10050898 |
| Molecular Formula | C23H35N3O4S2 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | methyl (2S)-2-[[(2S,4R)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-methoxyphenyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)[C@@H]1C[C@H](c2ccccc2OC)CN1C/C=C/[C@@H](N)CS |
| InChI | InChI=1S/C23H35N3O4S2/c1-29-21-9-5-4-8-18(21)16-13-20(26(14-16)11-6-7-17(24)15-31)22(27)25-19(10-12-32-3)23(28)30-2/h4-9,16-17,19-20,31H,10-15,24H2,1-3H3,(H,25,27)/b7-6+/t16-,17+,19-,20-/m0/s1 |
| InChIKey | HPAOZMILQBLYPZ-DJZIBZFWSA-N |
| XLogP | 2.08 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|