C26H35N3O4S2 — CID 118718329
methyl (2S)-2-[[(2S,4S)-1-[(E)-4-amino-5-sulfanylpent-2-enyl]-4-naphthalen-1-yloxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 118718329) has the molecular formula C26H35N3O4S2 and a molecular weight of 517.72 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,4S)-1-[(E)-4-amino-5-sulfanylpent-2-enyl]-4-naphthalen-1-yloxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S,4S)-1-[(E)-4-amino-5-sulfanylpent-2-enyl]-4-naphthalen-1-yloxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 118718329 |
| Molecular Formula | C26H35N3O4S2 |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | methyl (2S)-2-[[(2S,4S)-1-[(E)-4-amino-5-sulfanylpent-2-enyl]-4-naphthalen-1-yloxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)[C@@H]1C[C@H](Oc2cccc3ccccc23)CN1C/C=C/C(N)CS |
| InChI | InChI=1S/C26H35N3O4S2/c1-32-26(31)22(12-14-35-2)28-25(30)23-15-20(16-29(23)13-6-9-19(27)17-34)33-24-11-5-8-18-7-3-4-10-21(18)24/h3-11,19-20,22-23,34H,12-17,27H2,1-2H3,(H,28,30)/b9-6+/t19?,20-,22-,23-/m0/s1 |
| InChIKey | AJMJZQOMQSQWHF-UXWDUWDLSA-N |
| XLogP | 2.89 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|