C25H39N3O4S2 — CID 56678469
methyl (2R)-2-[[(2R,4S)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-propylphenoxy)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 56678469) has the molecular formula C25H39N3O4S2 and a molecular weight of 509.74 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R,4S)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-propylphenoxy)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[[(2R,4S)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-propylphenoxy)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 56678469 |
| Molecular Formula | C25H39N3O4S2 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | methyl (2R)-2-[[(2R,4S)-1-[(E,4R)-4-amino-5-sulfanylpent-2-enyl]-4-(2-propylphenoxy)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCc1ccccc1O[C@H]1C[C@H](C(=O)N[C@H](CCSC)C(=O)OC)N(C/C=C/[C@@H](N)CS)C1 |
| InChI | InChI=1S/C25H39N3O4S2/c1-4-8-18-9-5-6-11-23(18)32-20-15-22(28(16-20)13-7-10-19(26)17-33)24(29)27-21(12-14-34-3)25(30)31-2/h5-7,9-11,19-22,33H,4,8,12-17,26H2,1-3H3,(H,27,29)/b10-7+/t19-,20+,21-,22-/m1/s1 |
| InChIKey | PPFSPSPQEGLBCJ-HKULCTPXSA-N |
| XLogP | 2.68 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|