C20H30N2O3S2 — CID 59921289
methyl (2S)-2-[[5-[(E)-4-amino-5-sulfanylpent-2-enyl]-2-ethylbenzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 59921289) has the molecular formula C20H30N2O3S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is methyl (2S)-2-[[5-[(E)-4-amino-5-sulfanylpent-2-enyl]-2-ethylbenzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[5-[(E)-4-amino-5-sulfanylpent-2-enyl]-2-ethylbenzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 59921289 |
| Molecular Formula | C20H30N2O3S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | methyl (2S)-2-[[5-[(E)-4-amino-5-sulfanylpent-2-enyl]-2-ethylbenzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCc1ccc(C/C=C/C(N)CS)cc1C(=O)N[C@@H](CCSC)C(=O)OC |
| InChI | InChI=1S/C20H30N2O3S2/c1-4-15-9-8-14(6-5-7-16(21)13-26)12-17(15)19(23)22-18(10-11-27-3)20(24)25-2/h5,7-9,12,16,18,26H,4,6,10-11,13,21H2,1-3H3,(H,22,23)/b7-5+/t16?,18-/m0/s1 |
| InChIKey | ZOEIBTLLWNXLNX-OLTSGPDHSA-N |
| XLogP | 2.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|