C22H33N3O4S2 — CID 176732094
methyl (2S)-2-[[(2S,4R)-1-[(4R)-4-amino-5-sulfanylpent-2-enyl]-4-phenoxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 176732094) has the molecular formula C22H33N3O4S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,4R)-1-[(4R)-4-amino-5-sulfanylpent-2-enyl]-4-phenoxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S,4R)-1-[(4R)-4-amino-5-sulfanylpent-2-enyl]-4-phenoxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 176732094 |
| Molecular Formula | C22H33N3O4S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | methyl (2S)-2-[[(2S,4R)-1-[(4R)-4-amino-5-sulfanylpent-2-enyl]-4-phenoxypyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)[C@@H]1C[C@@H](Oc2ccccc2)CN1CC=C[C@@H](N)CS |
| InChI | InChI=1S/C22H33N3O4S2/c1-28-22(27)19(10-12-31-2)24-21(26)20-13-18(29-17-8-4-3-5-9-17)14-25(20)11-6-7-16(23)15-30/h3-9,16,18-20,30H,10-15,23H2,1-2H3,(H,24,26)/t16-,18-,19+,20+/m1/s1 |
| InChIKey | DAKLZKDSHKWINM-LMCOJAPRSA-N |
| XLogP | 1.73 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|