C21H24N6O2S — CID 100571054
ethyl 4-methyl-2-[2-[(2-methylquinolin-4-yl)amino]ethylcarbamothioylamino]pyrimidine-5-carboxylate (PubChem CID 100571054) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is ethyl 4-methyl-2-[2-[(2-methylquinolin-4-yl)amino]ethylcarbamothioylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[2-[(2-methylquinolin-4-yl)amino]ethylcarbamothioylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 100571054 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | ethyl 4-methyl-2-[2-[(2-methylquinolin-4-yl)amino]ethylcarbamothioylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=S)NCCNc2cc(C)nc3ccccc23)nc1C |
| InChI | InChI=1S/C21H24N6O2S/c1-4-29-19(28)16-12-24-20(26-14(16)3)27-21(30)23-10-9-22-18-11-13(2)25-17-8-6-5-7-15(17)18/h5-8,11-12H,4,9-10H2,1-3H3,(H,22,25)(H2,23,24,26,27,30) |
| InChIKey | ZEPSREODLMVADM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|