C10H12ClNO3S2 — CID 100587610
4-methylsulfanyl-3-(propanoylamino)benzenesulfonyl chloride (PubChem CID 100587610) has the molecular formula C10H12ClNO3S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is 4-methylsulfanyl-3-(propanoylamino)benzenesulfonyl chloride.
| Compound Name | 4-methylsulfanyl-3-(propanoylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 100587610 |
| Molecular Formula | C10H12ClNO3S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 4-methylsulfanyl-3-(propanoylamino)benzenesulfonyl chloride |
| SMILES | CCC(=O)Nc1cc(S(=O)(=O)Cl)ccc1SC |
| InChI | InChI=1S/C10H12ClNO3S2/c1-3-10(13)12-8-6-7(17(11,14)15)4-5-9(8)16-2/h4-6H,3H2,1-2H3,(H,12,13) |
| InChIKey | USYLGENSCABEPZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |