C16H13N3 — CID 10060534
5-pyridin-4-yl-2,3-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 10060534) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-pyridin-4-yl-2,3-dihydroimidazo[2,1-a]isoquinoline.
| Compound Name | 5-pyridin-4-yl-2,3-dihydroimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 10060534 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-pyridin-4-yl-2,3-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | C1=C(c2ccncc2)N2CCN=C2c2ccccc21 |
| InChI | InChI=1S/C16H13N3/c1-2-4-14-13(3-1)11-15(12-5-7-17-8-6-12)19-10-9-18-16(14)19/h1-8,11H,9-10H2 |
| InChIKey | MFVYQGMRRKNURM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |