C25H28N2 — CID 10406000
5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,3-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 10406000) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,3-dihydroimidazo[2,1-a]isoquinoline.
| Compound Name | 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,3-dihydroimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 10406000 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2,3-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | CC1(C)CCC(C)(C)c2cc(C3=Cc4ccccc4C4=NCCN34)ccc21 |
| InChI | InChI=1S/C25H28N2/c1-24(2)11-12-25(3,4)21-15-18(9-10-20(21)24)22-16-17-7-5-6-8-19(17)23-26-13-14-27(22)23/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | FWCAFHGRKGZSJA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|