C27H26N2O4 — CID 23167688
5-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 23167688) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 5-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline.
| Compound Name | 5-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 23167688 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 5-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | COc1cc(COc2ccc(C3=Cc4ccccc4C4=NCCN34)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H26N2O4/c1-30-24-14-18(15-25(31-2)26(24)32-3)17-33-21-10-8-19(9-11-21)23-16-20-6-4-5-7-22(20)27-28-12-13-29(23)27/h4-11,14-16H,12-13,17H2,1-3H3 |
| InChIKey | GZBIOWVTSPSJHG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|