C27H28N2O4 — CID 14964722
11-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene (PubChem CID 14964722) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 11-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene.
| Compound Name | 11-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene |
|---|---|
| PubChem CID | 14964722 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 11-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene |
| SMILES | COc1cc(CCc2ccc(C3=Cc4oc(C)cc4C4=NCCN34)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H28N2O4/c1-17-13-21-23(33-17)16-22(29-12-11-28-27(21)29)20-9-7-18(8-10-20)5-6-19-14-24(30-2)26(32-4)25(15-19)31-3/h7-10,13-16H,5-6,11-12H2,1-4H3 |
| InChIKey | QQVLNGXUFWKFIG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 56.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |