C16H28OSi — CID 10061373
[(1R,2S,3aS)-1-ethenyl-1,2,3,3a,4,5-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10061373) has the molecular formula C16H28OSi and a molecular weight of 264.49 g/mol. Its IUPAC name is [(1R,2S,3aS)-1-ethenyl-1,2,3,3a,4,5-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S,3aS)-1-ethenyl-1,2,3,3a,4,5-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10061373 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | [(1R,2S,3aS)-1-ethenyl-1,2,3,3a,4,5-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H]1C2=CCC[C@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28OSi/c1-7-13-14-10-8-9-12(14)11-15(13)17-18(5,6)16(2,3)4/h7,10,12-13,15H,1,8-9,11H2,2-6H3/t12-,13+,15-/m0/s1 |
| InChIKey | IZGNWKNCAVESIC-GUTXKFCHSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|