C16H23N5O2S — CID 100627148
N-[3-(pyridin-3-ylmethylamino)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide (PubChem CID 100627148) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[3-(pyridin-3-ylmethylamino)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide.
| Compound Name | N-[3-(pyridin-3-ylmethylamino)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 100627148 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[3-(pyridin-3-ylmethylamino)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide |
| SMILES | O=S(=O)(NCCCNCc1cccnc1)c1cn2c(n1)CCCC2 |
| InChI | InChI=1S/C16H23N5O2S/c22-24(23,16-13-21-10-2-1-6-15(21)20-16)19-9-4-8-18-12-14-5-3-7-17-11-14/h3,5,7,11,13,18-19H,1-2,4,6,8-10,12H2 |
| InChIKey | HCMROAIDOFLRSY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|