C15H16F2N2O3S — CID 100627300
3-[[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]amino]benzenesulfonamide (PubChem CID 100627300) has the molecular formula C15H16F2N2O3S and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 100627300 |
| Molecular Formula | C15H16F2N2O3S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 3-[[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]amino]benzenesulfonamide |
| SMILES | C[C@H](COc1ccc(F)c(F)c1)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H16F2N2O3S/c1-10(9-22-12-5-6-14(16)15(17)8-12)19-11-3-2-4-13(7-11)23(18,20)21/h2-8,10,19H,9H2,1H3,(H2,18,20,21)/t10-/m1/s1 |
| InChIKey | OOZJHMWLKIMNCK-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |