C19H16O3 — CID 10062910
(1S,8S,11R,12R)-11-methyl-10-oxo-8-phenyl-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carbaldehyde (PubChem CID 10062910) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1S,8S,11R,12R)-11-methyl-10-oxo-8-phenyl-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carbaldehyde.
| Compound Name | (1S,8S,11R,12R)-11-methyl-10-oxo-8-phenyl-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carbaldehyde |
|---|---|
| PubChem CID | 10062910 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (1S,8S,11R,12R)-11-methyl-10-oxo-8-phenyl-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carbaldehyde |
| SMILES | C[C@H]1[C@@H]2C(=O)O[C@@](c3ccccc3)(c3ccccc32)[C@@H]1C=O |
| InChI | InChI=1S/C19H16O3/c1-12-16(11-20)19(13-7-3-2-4-8-13)15-10-6-5-9-14(15)17(12)18(21)22-19/h2-12,16-17H,1H3/t12-,16-,17+,19+/m1/s1 |
| InChIKey | BPYZYYVPFLRKIN-JOCQJMSRSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|