C17H19O5P — CID 10065452
5-(4-phenylphenyl)-2-phosphonopentanoic acid (PubChem CID 10065452) has the molecular formula C17H19O5P and a molecular weight of 334.31 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-2-phosphonopentanoic acid.
| Compound Name | 5-(4-phenylphenyl)-2-phosphonopentanoic acid |
|---|---|
| PubChem CID | 10065452 |
| Molecular Formula | C17H19O5P |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-(4-phenylphenyl)-2-phosphonopentanoic acid |
| SMILES | O=C(O)C(CCCc1ccc(-c2ccccc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C17H19O5P/c18-17(19)16(23(20,21)22)8-4-5-13-9-11-15(12-10-13)14-6-2-1-3-7-14/h1-3,6-7,9-12,16H,4-5,8H2,(H,18,19)(H2,20,21,22) |
| InChIKey | QNIGGUIVSJGJNF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|