About CID 10067126
CID 10067126 (PubChem CID 10067126) has the molecular formula C18H22BNO6-
and a molecular weight of 359.19 g/mol.
Molecular Properties
| Compound Name | CID 10067126 |
| PubChem CID | 10067126 |
| Molecular Formula | C18H22BNO6- |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | — |
| SMILES | CCO/C(O[B-](OC(C)=O)OC(C)=O)=C1\CCC\C1=N/c1ccccc1 |
| InChI | InChI=1S/C18H22BNO6/c1-4-23-18(26-19(24-13(2)21)25-14(3)22)16-11-8-12-17(16)20-15-9-6-5-7-10-15/h5-7,9-10H,4,8,11-12H2,1-3H3/q-1/b18-16-,20-17+ |
| InChIKey | VFOBUPFUYCIYGP-OPMCAQPSSA-N |
| XLogP | 3.32 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 10067126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10067126?
The IUPAC name of CID 10067126 (CID 10067126) is not available.
What is the SMILES notation for CID 10067126?
The canonical SMILES for CID 10067126 is CCO/C(O[B-](OC(C)=O)OC(C)=O)=C1\CCC\C1=N/c1ccccc1.
What is the InChIKey of CID 10067126?
The InChIKey is VFOBUPFUYCIYGP-OPMCAQPSSA-N. The full InChI is InChI=1S/C18H22BNO6/c1-4-23-18(26-19(24-13(2)21)25-14(3)22)16-11-8-12-17(16)20-15-9-6-5-7-10-15/h5-7,9-10H,4,8,11-12H2,1-3H3/q-1/b18-16-,20-17+.
What are the key properties of CID 10067126?
CID 10067126 has a molecular weight of 359.19 g/mol, XLogP of 3.32, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10067126 is sourced from PubChem (CID 10067126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).