C17H15ClN4O3S3 — CID 100677926
5-(benzenesulfonamido)-2-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100677926) has the molecular formula C17H15ClN4O3S3 and a molecular weight of 454.99 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 5-(benzenesulfonamido)-2-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100677926 |
| Molecular Formula | C17H15ClN4O3S3 |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | 5-(benzenesulfonamido)-2-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCSc1nnc(NC(=O)c2cc(NS(=O)(=O)c3ccccc3)ccc2Cl)s1 |
| InChI | InChI=1S/C17H15ClN4O3S3/c1-2-26-17-21-20-16(27-17)19-15(23)13-10-11(8-9-14(13)18)22-28(24,25)12-6-4-3-5-7-12/h3-10,22H,2H2,1H3,(H,19,20,23) |
| InChIKey | HOJRXTOLAKVKDV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|