C19H24NO5P — CID 10068150
1-diethoxyphosphoryl-N-hydroxy-1,1-diphenylpropan-2-imine oxide (PubChem CID 10068150) has the molecular formula C19H24NO5P and a molecular weight of 377.38 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-hydroxy-1,1-diphenylpropan-2-imine oxide.
| Compound Name | 1-diethoxyphosphoryl-N-hydroxy-1,1-diphenylpropan-2-imine oxide |
|---|---|
| PubChem CID | 10068150 |
| Molecular Formula | C19H24NO5P |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-diethoxyphosphoryl-N-hydroxy-1,1-diphenylpropan-2-imine oxide |
| SMILES | CCOP(=O)(OCC)C(/C(C)=[N+](/[O-])O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24NO5P/c1-4-24-26(23,25-5-2)19(16(3)20(21)22,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15H,4-5H2,1-3H3,(H,21,22) |
| InChIKey | RHUCZJRJQVEMHF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|