C16H27NO7P2 — CID 132564098
N-[bis(diethoxyphosphoryl)-phenylmethyl]formamide (PubChem CID 132564098) has the molecular formula C16H27NO7P2 and a molecular weight of 407.34 g/mol. Its IUPAC name is N-[bis(diethoxyphosphoryl)-phenylmethyl]formamide.
| Compound Name | N-[bis(diethoxyphosphoryl)-phenylmethyl]formamide |
|---|---|
| PubChem CID | 132564098 |
| Molecular Formula | C16H27NO7P2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[bis(diethoxyphosphoryl)-phenylmethyl]formamide |
| SMILES | CCOP(=O)(OCC)C(NC=O)(c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H27NO7P2/c1-5-21-25(19,22-6-2)16(17-14-18,15-12-10-9-11-13-15)26(20,23-7-3)24-8-4/h9-14H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | RHXLIQHSMHETIF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|