C22H20BrN3O2 — CID 100740921
N'-[1-(4-bromophenyl)cyclopentyl]-N-quinolin-8-yloxamide (PubChem CID 100740921) has the molecular formula C22H20BrN3O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is N'-[1-(4-bromophenyl)cyclopentyl]-N-quinolin-8-yloxamide.
| Compound Name | N'-[1-(4-bromophenyl)cyclopentyl]-N-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 100740921 |
| Molecular Formula | C22H20BrN3O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N'-[1-(4-bromophenyl)cyclopentyl]-N-quinolin-8-yloxamide |
| SMILES | O=C(Nc1cccc2cccnc12)C(=O)NC1(c2ccc(Br)cc2)CCCC1 |
| InChI | InChI=1S/C22H20BrN3O2/c23-17-10-8-16(9-11-17)22(12-1-2-13-22)26-21(28)20(27)25-18-7-3-5-15-6-4-14-24-19(15)18/h3-11,14H,1-2,12-13H2,(H,25,27)(H,26,28) |
| InChIKey | OYYVUSZRXPZBOZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|