C29H36O7 — CID 10074545
(E,4S,5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-bis(phenylmethoxy)pent-2-enal (PubChem CID 10074545) has the molecular formula C29H36O7 and a molecular weight of 496.60 g/mol. Its IUPAC name is (E,4S,5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-bis(phenylmethoxy)pent-2-enal.
| Compound Name | (E,4S,5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-bis(phenylmethoxy)pent-2-enal |
|---|---|
| PubChem CID | 10074545 |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (E,4S,5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-bis(phenylmethoxy)pent-2-enal |
| SMILES | CC1(C)O[C@H]([C@H](OCc2ccccc2)[C@H](/C=C/C=O)OCc2ccccc2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C29H36O7/c1-28(2)33-20-24(34-28)26-27(36-29(3,4)35-26)25(32-19-22-14-9-6-10-15-22)23(16-11-17-30)31-18-21-12-7-5-8-13-21/h5-17,23-27H,18-20H2,1-4H3/b16-11+/t23-,24+,25+,26+,27+/m0/s1 |
| InChIKey | RRDCLNMJRQQLCH-KNIBJTMESA-N |
| XLogP | 4.58 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|