C25H52N10O3 — CID 10075974
[[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]amino] 9-(diaminomethylideneamino)nonanoate (PubChem CID 10075974) has the molecular formula C25H52N10O3 and a molecular weight of 540.76 g/mol. Its IUPAC name is [[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]amino] 9-(diaminomethylideneamino)nonanoate.
| Compound Name | [[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]amino] 9-(diaminomethylideneamino)nonanoate |
|---|---|
| PubChem CID | 10075974 |
| Molecular Formula | C25H52N10O3 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | [[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]amino] 9-(diaminomethylideneamino)nonanoate |
| SMILES | NC(N)=NCCCCCCCCC(=O)ONC(CCCN=C(N)N)C(=O)CCCCCCCCN=C(N)N |
| InChI | InChI=1S/C25H52N10O3/c26-23(27)32-17-11-7-3-1-5-9-15-21(36)20(14-13-19-34-25(30)31)35-38-22(37)16-10-6-2-4-8-12-18-33-24(28)29/h20,35H,1-19H2,(H4,26,27,32)(H4,28,29,33)(H4,30,31,34) |
| InChIKey | AGKPXQRIQAXREL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 248.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|