C20H22N2O3 — CID 100761442
5-[[(2R)-4-benzyl-1,4-oxazepan-2-yl]methyl]furo[3,2-c]pyridin-4-one (PubChem CID 100761442) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-[[(2R)-4-benzyl-1,4-oxazepan-2-yl]methyl]furo[3,2-c]pyridin-4-one.
| Compound Name | 5-[[(2R)-4-benzyl-1,4-oxazepan-2-yl]methyl]furo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 100761442 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 5-[[(2R)-4-benzyl-1,4-oxazepan-2-yl]methyl]furo[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccoc2ccn1C[C@H]1CN(Cc2ccccc2)CCCO1 |
| InChI | InChI=1S/C20H22N2O3/c23-20-18-8-12-25-19(18)7-10-22(20)15-17-14-21(9-4-11-24-17)13-16-5-2-1-3-6-16/h1-3,5-8,10,12,17H,4,9,11,13-15H2/t17-/m1/s1 |
| InChIKey | LBEAAAVUGDHWEH-QGZVFWFLSA-N |
| XLogP | 2.89 |
| TPSA | 47.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |