C24H29N3O3 — CID 166211904
3-[(4-benzyl-1,4-oxazepan-2-yl)methyl]-5-methyl-5-(2-methylphenyl)imidazolidine-2,4-dione (PubChem CID 166211904) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[(4-benzyl-1,4-oxazepan-2-yl)methyl]-5-methyl-5-(2-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(4-benzyl-1,4-oxazepan-2-yl)methyl]-5-methyl-5-(2-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166211904 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-[(4-benzyl-1,4-oxazepan-2-yl)methyl]-5-methyl-5-(2-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccccc1C1(C)NC(=O)N(CC2CN(Cc3ccccc3)CCCO2)C1=O |
| InChI | InChI=1S/C24H29N3O3/c1-18-9-6-7-12-21(18)24(2)22(28)27(23(29)25-24)17-20-16-26(13-8-14-30-20)15-19-10-4-3-5-11-19/h3-7,9-12,20H,8,13-17H2,1-2H3,(H,25,29) |
| InChIKey | SYNMLZDGOISPGL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|