C29H26Cl2N4O3 — CID 10076212
4-[4-[(Z)-N-[(3,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]anilino]-6-methoxy-7-propan-2-yloxyquinoline-3-carbonitrile (PubChem CID 10076212) has the molecular formula C29H26Cl2N4O3 and a molecular weight of 549.46 g/mol. Its IUPAC name is 4-[4-[(Z)-N-[(3,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]anilino]-6-methoxy-7-propan-2-yloxyquinoline-3-carbonitrile.
| Compound Name | 4-[4-[(Z)-N-[(3,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]anilino]-6-methoxy-7-propan-2-yloxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 10076212 |
| Molecular Formula | C29H26Cl2N4O3 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 4-[4-[(Z)-N-[(3,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]anilino]-6-methoxy-7-propan-2-yloxyquinoline-3-carbonitrile |
| SMILES | COc1cc2c(Nc3ccc(/C(C)=N\OCc4ccc(Cl)c(Cl)c4)cc3)c(C#N)cnc2cc1OC(C)C |
| InChI | InChI=1S/C29H26Cl2N4O3/c1-17(2)38-28-13-26-23(12-27(28)36-4)29(21(14-32)15-33-26)34-22-8-6-20(7-9-22)18(3)35-37-16-19-5-10-24(30)25(31)11-19/h5-13,15,17H,16H2,1-4H3,(H,33,34)/b35-18- |
| InChIKey | NHONDSJWKUFULL-AEUUOICLSA-N |
| XLogP | 7.89 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|