C17H19N3O7S — CID 100762536
methyl (2S,3aR,5R,7aR)-4-(2-cyano-3-nitrophenyl)sulfonyl-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate (PubChem CID 100762536) has the molecular formula C17H19N3O7S and a molecular weight of 409.42 g/mol. Its IUPAC name is methyl (2S,3aR,5R,7aR)-4-(2-cyano-3-nitrophenyl)sulfonyl-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate.
| Compound Name | methyl (2S,3aR,5R,7aR)-4-(2-cyano-3-nitrophenyl)sulfonyl-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 100762536 |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | methyl (2S,3aR,5R,7aR)-4-(2-cyano-3-nitrophenyl)sulfonyl-5-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2[C@@H](CC[C@@H](C)N2S(=O)(=O)c2cccc([N+](=O)[O-])c2C#N)O1 |
| InChI | InChI=1S/C17H19N3O7S/c1-10-6-7-14-13(8-15(27-14)17(21)26-2)19(10)28(24,25)16-5-3-4-12(20(22)23)11(16)9-18/h3-5,10,13-15H,6-8H2,1-2H3/t10-,13-,14-,15+/m1/s1 |
| InChIKey | LEJHDYDBVWZACV-QZKOUSHUSA-N |
| XLogP | 1.34 |
| TPSA | 139.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|