C15H16N6O4S — CID 120894950
2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonyl-6-nitrobenzonitrile (PubChem CID 120894950) has the molecular formula C15H16N6O4S and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonyl-6-nitrobenzonitrile.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonyl-6-nitrobenzonitrile |
|---|---|
| PubChem CID | 120894950 |
| Molecular Formula | C15H16N6O4S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonyl-6-nitrobenzonitrile |
| SMILES | Cn1ccnc1C1CNCCN1S(=O)(=O)c1cccc([N+](=O)[O-])c1C#N |
| InChI | InChI=1S/C15H16N6O4S/c1-19-7-6-18-15(19)13-10-17-5-8-20(13)26(24,25)14-4-2-3-12(21(22)23)11(14)9-16/h2-4,6-7,13,17H,5,8,10H2,1H3 |
| InChIKey | GRFUZNKKOJDTAR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|