C18H25N5OS — CID 100777299
(3S)-1-benzyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide (PubChem CID 100777299) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is (3S)-1-benzyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-benzyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100777299 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3S)-1-benzyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
| SMILES | Cc1nc(SCCNC(=O)[C@H]2CCCN(Cc3ccccc3)C2)n[nH]1 |
| InChI | InChI=1S/C18H25N5OS/c1-14-20-18(22-21-14)25-11-9-19-17(24)16-8-5-10-23(13-16)12-15-6-3-2-4-7-15/h2-4,6-7,16H,5,8-13H2,1H3,(H,19,24)(H,20,21,22)/t16-/m0/s1 |
| InChIKey | UJPLUSWCQCHOOQ-INIZCTEOSA-N |
| XLogP | 2.23 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|