C39H74O4Si2 — CID 10078119
(3Z,5R,7E,11E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-triene-2,5-diol (PubChem CID 10078119) has the molecular formula C39H74O4Si2 and a molecular weight of 663.19 g/mol. Its IUPAC name is (3Z,5R,7E,11E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-triene-2,5-diol.
| Compound Name | (3Z,5R,7E,11E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-triene-2,5-diol |
|---|---|
| PubChem CID | 10078119 |
| Molecular Formula | C39H74O4Si2 |
| Molecular Weight | 663.19 g/mol |
| Exact Mass | 662.51 |
| IUPAC Name | (3Z,5R,7E,11E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-triene-2,5-diol |
| SMILES | CC1=C(CC/C(C)=C/CC/C(=C\C[C@@H](O)/C(=C\C(C)(C)O)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C39H74O4Si2/c1-30(22-24-34-31(2)20-18-26-38(34,9)10)19-17-21-32(28-42-44(13,14)36(3,4)5)23-25-35(40)33(27-39(11,12)41)29-43-45(15,16)37(6,7)8/h19,23,27,35,40-41H,17-18,20-22,24-26,28-29H2,1-16H3/b30-19+,32-23+,33-27-/t35-/m1/s1 |
| InChIKey | STPIICHUVNFDBD-JDCVXQNLSA-N |
| XLogP | 11.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.19 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|