C9H9FN4O2S — CID 100786197
5-[(3-fluorophenyl)methylsulfonyl]-1H-1,2,4-triazol-3-amine (PubChem CID 100786197) has the molecular formula C9H9FN4O2S and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methylsulfonyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[(3-fluorophenyl)methylsulfonyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 100786197 |
| Molecular Formula | C9H9FN4O2S |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 5-[(3-fluorophenyl)methylsulfonyl]-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(S(=O)(=O)Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C9H9FN4O2S/c10-7-3-1-2-6(4-7)5-17(15,16)9-12-8(11)13-14-9/h1-4H,5H2,(H3,11,12,13,14) |
| InChIKey | FHOSSKJWMKUVHH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |