C14H17N3O5S — CID 100830319
6-(4-acetylpiperazin-1-yl)sulfonyl-5-methyl-3H-1,3-benzoxazol-2-one (PubChem CID 100830319) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is 6-(4-acetylpiperazin-1-yl)sulfonyl-5-methyl-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(4-acetylpiperazin-1-yl)sulfonyl-5-methyl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 100830319 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 6-(4-acetylpiperazin-1-yl)sulfonyl-5-methyl-3H-1,3-benzoxazol-2-one |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cc3oc(=O)[nH]c3cc2C)CC1 |
| InChI | InChI=1S/C14H17N3O5S/c1-9-7-11-12(22-14(19)15-11)8-13(9)23(20,21)17-5-3-16(4-6-17)10(2)18/h7-8H,3-6H2,1-2H3,(H,15,19) |
| InChIKey | CNLBRGGWAGIPLE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |