C14H18FNO3 — CID 10084329
(3S,4R)-1-benzyl-4-fluoro-3-[1-(methoxymethoxy)ethyl]azetidin-2-one (PubChem CID 10084329) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-fluoro-3-[1-(methoxymethoxy)ethyl]azetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-4-fluoro-3-[1-(methoxymethoxy)ethyl]azetidin-2-one |
|---|---|
| PubChem CID | 10084329 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3S,4R)-1-benzyl-4-fluoro-3-[1-(methoxymethoxy)ethyl]azetidin-2-one |
| SMILES | COCOC(C)[C@H]1C(=O)N(Cc2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C14H18FNO3/c1-10(19-9-18-2)12-13(15)16(14(12)17)8-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3/t10?,12-,13+/m1/s1 |
| InChIKey | NDQUUXSHWDWQSM-SOYIIFOFSA-N |
| XLogP | 1.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|