C17H25N3O4 — CID 100850894
[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 100850894) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 100850894 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)O[C@H]2C[C@H]3CC[C@@]2(C)C3(C)C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O4/c1-10-15(20(22)23)11(2)19(18-10)9-14(21)24-13-8-12-6-7-17(13,5)16(12,3)4/h12-13H,6-9H2,1-5H3/t12-,13+,17-/m1/s1 |
| InChIKey | IKHVUQJTSXZOJF-IIYDPXPESA-N |
| XLogP | 3.17 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|