C16H23N3O3S — CID 136857150
[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate (PubChem CID 136857150) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is [(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate.
| Compound Name | [(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 136857150 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
| SMILES | Cc1nnc(SCC(=O)O[C@@H]2C[C@H]3CC[C@@]2(C)C3(C)C)[nH]c1=O |
| InChI | InChI=1S/C16H23N3O3S/c1-9-13(21)17-14(19-18-9)23-8-12(20)22-11-7-10-5-6-16(11,4)15(10,2)3/h10-11H,5-8H2,1-4H3,(H,17,19,21)/t10-,11-,16-/m1/s1 |
| InChIKey | FGAJNXKYPNIMFS-GLKRBJQHSA-N |
| XLogP | 2.32 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |