C24H34N2O2 — CID 100867766
1-[(4aS,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethanone (PubChem CID 100867766) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[(4aS,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethanone.
| Compound Name | 1-[(4aS,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethanone |
|---|---|
| PubChem CID | 100867766 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-[(4aS,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethanone |
| SMILES | COc1ccc2c(c1)CCC[C@@H]2CC(=O)N1CC[C@H]2[C@@H](CCCN2C2CC2)C1 |
| InChI | InChI=1S/C24H34N2O2/c1-28-21-9-10-22-17(14-21)4-2-5-18(22)15-24(27)25-13-11-23-19(16-25)6-3-12-26(23)20-7-8-20/h9-10,14,18-20,23H,2-8,11-13,15-16H2,1H3/t18-,19+,23+/m1/s1 |
| InChIKey | RCAQUYUHBJWHCI-MSYCTHLASA-N |
| XLogP | 3.98 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |