C30H25N — CID 100886473
(1S,4S,5S,6R,7S)-2,4,5,7-tetraphenyl-3-azabicyclo[4.1.0]hept-2-ene (PubChem CID 100886473) has the molecular formula C30H25N and a molecular weight of 399.54 g/mol. Its IUPAC name is (1S,4S,5S,6R,7S)-2,4,5,7-tetraphenyl-3-azabicyclo[4.1.0]hept-2-ene.
| Compound Name | (1S,4S,5S,6R,7S)-2,4,5,7-tetraphenyl-3-azabicyclo[4.1.0]hept-2-ene |
|---|---|
| PubChem CID | 100886473 |
| Molecular Formula | C30H25N |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (1S,4S,5S,6R,7S)-2,4,5,7-tetraphenyl-3-azabicyclo[4.1.0]hept-2-ene |
| SMILES | c1ccc(C2=N[C@H](c3ccccc3)[C@H](c3ccccc3)[C@@H]3[C@H]2[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25N/c1-5-13-21(14-6-1)25-27-26(22-15-7-2-8-16-22)29(23-17-9-3-10-18-23)31-30(28(25)27)24-19-11-4-12-20-24/h1-20,25-29H/t25-,26+,27+,28+,29+/m0/s1 |
| InChIKey | LQIKMZRQDPPRMZ-MMBNBZRISA-N |
| XLogP | 7.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |