C18H24N6O2 — CID 10089624
2-[1-[2-[[5-(morpholin-4-ylmethyl)furan-2-yl]methylamino]ethyl]imidazolidin-2-ylidene]propanedinitrile (PubChem CID 10089624) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[1-[2-[[5-(morpholin-4-ylmethyl)furan-2-yl]methylamino]ethyl]imidazolidin-2-ylidene]propanedinitrile.
| Compound Name | 2-[1-[2-[[5-(morpholin-4-ylmethyl)furan-2-yl]methylamino]ethyl]imidazolidin-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 10089624 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-[1-[2-[[5-(morpholin-4-ylmethyl)furan-2-yl]methylamino]ethyl]imidazolidin-2-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1NCCN1CCNCc1ccc(CN2CCOCC2)o1 |
| InChI | InChI=1S/C18H24N6O2/c19-11-15(12-20)18-22-4-6-24(18)5-3-21-13-16-1-2-17(26-16)14-23-7-9-25-10-8-23/h1-2,21-22H,3-10,13-14H2 |
| InChIKey | NHGBGMKXMPIVTG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|