C19H21CoN2O2- — CID 10090287
cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentylamino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 10090287) has the molecular formula C19H21CoN2O2- and a molecular weight of 368.32 g/mol. Its IUPAC name is cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentylamino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 10090287 |
| Molecular Formula | C19H21CoN2O2- |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentylamino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | [CH2-]CCC(CN/C=C1/C=CC=CC1=O)N/C=C1/C=CC=CC1=O.[Co] |
| InChI | InChI=1S/C19H21N2O2.Co/c1-2-7-17(21-13-16-9-4-6-11-19(16)23)14-20-12-15-8-3-5-10-18(15)22;/h3-6,8-13,17,20-21H,1-2,7,14H2;/q-1;/b15-12-,16-13-; |
| InChIKey | HVJFQIQVBSWPNR-UUZLJJPRSA-N |
| XLogP | 2.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|